C26H39BN2O4 — CID 151496438
N-[(1S)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2R)-pyrrolidin-2-yl]methoxy]propanamide (PubChem CID 151496438) has the molecular formula C26H39BN2O4 and a molecular weight of 454.42 g/mol. Its IUPAC name is N-[(1S)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2R)-pyrrolidin-2-yl]methoxy]propanamide.
| Compound Name | N-[(1S)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2R)-pyrrolidin-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 151496438 |
| Molecular Formula | C26H39BN2O4 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | N-[(1S)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2R)-pyrrolidin-2-yl]methoxy]propanamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@@H](Cc4ccccc4)NC(=O)CCOC[C@H]4CCCN4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C26H39BN2O4/c1-25(2)19-15-21(25)26(3)22(16-19)32-27(33-26)23(14-18-8-5-4-6-9-18)29-24(30)11-13-31-17-20-10-7-12-28-20/h4-6,8-9,19-23,28H,7,10-17H2,1-3H3,(H,29,30)/t19-,20+,21-,22+,23+,26-/m0/s1 |
| InChIKey | PPNCCTLYSGIHOR-PYPPLFHRSA-N |
| XLogP | 3.14 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|