C29H43BN2O6 — CID 142596129
tert-butyl (2S)-2-[2-oxo-2-[[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]ethyl]morpholine-4-carboxylate (PubChem CID 142596129) has the molecular formula C29H43BN2O6 and a molecular weight of 526.48 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-oxo-2-[[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]ethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-oxo-2-[[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]ethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 142596129 |
| Molecular Formula | C29H43BN2O6 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | tert-butyl (2S)-2-[2-oxo-2-[[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]amino]ethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](CC(=O)N[C@@H](Cc2ccccc2)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)C1 |
| InChI | InChI=1S/C29H43BN2O6/c1-27(2,3)36-26(34)32-12-13-35-21(18-32)17-25(33)31-24(14-19-10-8-7-9-11-19)30-37-23-16-20-15-22(28(20,4)5)29(23,6)38-30/h7-11,20-24H,12-18H2,1-6H3,(H,31,33)/t20-,21-,22-,23+,24-,29-/m0/s1 |
| InChIKey | NWQMLIMJGHSOSM-OJCYWDJOSA-N |
| XLogP | 4.01 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|