C25H38BN3O3 — CID 142596560
1-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2S)-piperidin-2-yl]methyl]urea (PubChem CID 142596560) has the molecular formula C25H38BN3O3 and a molecular weight of 439.41 g/mol. Its IUPAC name is 1-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2S)-piperidin-2-yl]methyl]urea.
| Compound Name | 1-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2S)-piperidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 142596560 |
| Molecular Formula | C25H38BN3O3 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | 1-[(1R)-2-phenyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-[[(2S)-piperidin-2-yl]methyl]urea |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4ccccc4)NC(=O)NC[C@@H]4CCCCN4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C25H38BN3O3/c1-24(2)18-14-20(24)25(3)21(15-18)31-26(32-25)22(13-17-9-5-4-6-10-17)29-23(30)28-16-19-11-7-8-12-27-19/h4-6,9-10,18-22,27H,7-8,11-16H2,1-3H3,(H2,28,29,30)/t18-,19-,20-,21+,22-,25-/m0/s1 |
| InChIKey | PLZWWETXECKBJV-ZTADCWEZSA-N |
| XLogP | 3.31 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|