C25H40BN3O3 — CID 142596338
1-methyl-3-[2-phenyl-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea;piperidine (PubChem CID 142596338) has the molecular formula C25H40BN3O3 and a molecular weight of 441.43 g/mol. Its IUPAC name is 1-methyl-3-[2-phenyl-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea;piperidine.
| Compound Name | 1-methyl-3-[2-phenyl-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea;piperidine |
|---|---|
| PubChem CID | 142596338 |
| Molecular Formula | C25H40BN3O3 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 1-methyl-3-[2-phenyl-1-[(2S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]urea;piperidine |
| SMILES | C1CCNCC1.CNC(=O)NC(Cc1ccccc1)B1OC2CC3CC(C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C20H29BN2O3.C5H11N/c1-19(2)14-11-15(19)20(3)16(12-14)25-21(26-20)17(23-18(24)22-4)10-13-8-6-5-7-9-13;1-2-4-6-5-3-1/h5-9,14-17H,10-12H2,1-4H3,(H2,22,23,24);6H,1-5H2/t14?,15?,16?,17?,20-;/m0./s1 |
| InChIKey | FZVFYAZNVMMGLE-SPTRALNVSA-N |
| XLogP | 3.55 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|