C23H35BN2O3 — CID 68773118
2-amino-2-methyl-N-[(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide (PubChem CID 68773118) has the molecular formula C23H35BN2O3 and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide.
| Compound Name | 2-amino-2-methyl-N-[(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 68773118 |
| Molecular Formula | C23H35BN2O3 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-amino-2-methyl-N-[(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]propanamide |
| SMILES | Cc1ccc(C[C@H](NC(=O)C(C)(C)N)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc1 |
| InChI | InChI=1S/C23H35BN2O3/c1-14-7-9-15(10-8-14)11-19(26-20(27)22(4,5)25)24-28-18-13-16-12-17(21(16,2)3)23(18,6)29-24/h7-10,16-19H,11-13,25H2,1-6H3,(H,26,27)/t16-,17-,18+,19-,23-/m0/s1 |
| InChIKey | CLZNRVCLVLGMQD-ZFXLNCEJSA-N |
| XLogP | 3.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|