C28H35BN4O4 — CID 173109357
N-[1-[[(1R)-2-(3-methylphenyl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamoyl]cyclopropyl]pyrazine-2-carboxamide (PubChem CID 173109357) has the molecular formula C28H35BN4O4 and a molecular weight of 502.42 g/mol. Its IUPAC name is N-[1-[[(1R)-2-(3-methylphenyl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamoyl]cyclopropyl]pyrazine-2-carboxamide.
| Compound Name | N-[1-[[(1R)-2-(3-methylphenyl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamoyl]cyclopropyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 173109357 |
| Molecular Formula | C28H35BN4O4 |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | N-[1-[[(1R)-2-(3-methylphenyl)-1-[(1S,2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]carbamoyl]cyclopropyl]pyrazine-2-carboxamide |
| SMILES | Cc1cccc(C[C@H](NC(=O)C2(NC(=O)c3cnccn3)CC2)B2O[C@@H]3CC4C[C@@H](C4(C)C)[C@]3(C)O2)c1 |
| InChI | InChI=1S/C28H35BN4O4/c1-17-6-5-7-18(12-17)13-23(29-36-22-15-19-14-21(26(19,2)3)27(22,4)37-29)32-25(35)28(8-9-28)33-24(34)20-16-30-10-11-31-20/h5-7,10-12,16,19,21-23H,8-9,13-15H2,1-4H3,(H,32,35)(H,33,34)/t19?,21-,22+,23-,27-/m0/s1 |
| InChIKey | RYHLLQZCUKZYIY-ZKPGVLQISA-N |
| XLogP | 3.04 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|