C25H44BNO2Si2 — CID 140861703
(1R)-2-(4-methylphenyl)-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 140861703) has the molecular formula C25H44BNO2Si2 and a molecular weight of 457.62 g/mol. Its IUPAC name is (1R)-2-(4-methylphenyl)-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)ethanamine.
| Compound Name | (1R)-2-(4-methylphenyl)-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)ethanamine |
|---|---|
| PubChem CID | 140861703 |
| Molecular Formula | C25H44BNO2Si2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | (1R)-2-(4-methylphenyl)-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | Cc1ccc(C[C@@H](B2O[C@@H]3CC4CC(C4(C)C)[C@]3(C)O2)N([Si](C)(C)C)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C25H44BNO2Si2/c1-18-11-13-19(14-12-18)15-23(27(30(5,6)7)31(8,9)10)26-28-22-17-20-16-21(24(20,2)3)25(22,4)29-26/h11-14,20-23H,15-17H2,1-10H3/t20?,21?,22-,23+,25+/m1/s1 |
| InChIKey | FOQXKTPKGVTWOL-OSBIAPMOSA-N |
| XLogP | 6.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|