C29H50BNO4Si2 — CID 70827713
tert-butyl 3-[(2R)-2-[bis(trimethylsilyl)amino]-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoate (PubChem CID 70827713) has the molecular formula C29H50BNO4Si2 and a molecular weight of 543.71 g/mol. Its IUPAC name is tert-butyl 3-[(2R)-2-[bis(trimethylsilyl)amino]-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoate.
| Compound Name | tert-butyl 3-[(2R)-2-[bis(trimethylsilyl)amino]-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 70827713 |
| Molecular Formula | C29H50BNO4Si2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.34 |
| IUPAC Name | tert-butyl 3-[(2R)-2-[bis(trimethylsilyl)amino]-2-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(C[C@@H](B2OC3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)N([Si](C)(C)C)[Si](C)(C)C)c1 |
| InChI | InChI=1S/C29H50BNO4Si2/c1-27(2,3)33-26(32)21-15-13-14-20(16-21)17-25(31(36(7,8)9)37(10,11)12)30-34-24-19-22-18-23(28(22,4)5)29(24,6)35-30/h13-16,22-25H,17-19H2,1-12H3/t22-,23-,24?,25-,29-/m0/s1 |
| InChIKey | FRYLKNNWFZBXRT-XJDQXHATSA-N |
| XLogP | 6.79 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|