C19H24BClO4 — CID 175710141
3-[(2S)-2-chloro-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoic acid (PubChem CID 175710141) has the molecular formula C19H24BClO4 and a molecular weight of 362.66 g/mol. Its IUPAC name is 3-[(2S)-2-chloro-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoic acid.
| Compound Name | 3-[(2S)-2-chloro-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175710141 |
| Molecular Formula | C19H24BClO4 |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-[(2S)-2-chloro-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]benzoic acid |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cl)Cc4cccc(C(=O)O)c4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C19H24BClO4/c1-18(2)13-9-14(18)19(3)15(10-13)24-20(25-19)16(21)8-11-5-4-6-12(7-11)17(22)23/h4-7,13-16H,8-10H2,1-3H3,(H,22,23)/t13-,14-,15+,16+,19-/m0/s1 |
| InChIKey | UXYWSSKSIOFDSA-DBDOFBCQSA-N |
| XLogP | 3.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|