C21H29BO3 — CID 134853728
(1S,2S,6R,8S)-2,9,9-trimethyl-4-[(2S)-1-phenylmethoxybut-3-en-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 134853728) has the molecular formula C21H29BO3 and a molecular weight of 340.27 g/mol. Its IUPAC name is (1S,2S,6R,8S)-2,9,9-trimethyl-4-[(2S)-1-phenylmethoxybut-3-en-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R,8S)-2,9,9-trimethyl-4-[(2S)-1-phenylmethoxybut-3-en-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 134853728 |
| Molecular Formula | C21H29BO3 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (1S,2S,6R,8S)-2,9,9-trimethyl-4-[(2S)-1-phenylmethoxybut-3-en-2-yl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=C[C@@H](COCc1ccccc1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C21H29BO3/c1-5-17(14-23-13-15-9-7-6-8-10-15)22-24-19-12-16-11-18(20(16,2)3)21(19,4)25-22/h5-10,16-19H,1,11-14H2,2-4H3/t16-,17-,18-,19+,21-/m0/s1 |
| InChIKey | DUMXIKNLRUUVFF-HZKQSDJQSA-N |
| XLogP | 4.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|