C20H29BO4 — CID 70267333
(2S,8S)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 70267333) has the molecular formula C20H29BO4 and a molecular weight of 344.26 g/mol. Its IUPAC name is (2S,8S)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (2S,8S)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 70267333 |
| Molecular Formula | C20H29BO4 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (2S,8S)-4-[2-[(4-methoxyphenyl)methoxy]ethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | COc1ccc(COCCB2OC3C[C@@H]4CC(C4(C)C)[C@]3(C)O2)cc1 |
| InChI | InChI=1S/C20H29BO4/c1-19(2)15-11-17(19)20(3)18(12-15)24-21(25-20)9-10-23-13-14-5-7-16(22-4)8-6-14/h5-8,15,17-18H,9-13H2,1-4H3/t15-,17?,18?,20-/m0/s1 |
| InChIKey | UOPUOFZCZXVPFZ-ZPQVWODMSA-N |
| XLogP | 3.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|