C17H23BO3 — CID 142649118
(1S,2S,6S,8S)-4-(2-methoxyphenyl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 142649118) has the molecular formula C17H23BO3 and a molecular weight of 286.18 g/mol. Its IUPAC name is (1S,2S,6S,8S)-4-(2-methoxyphenyl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6S,8S)-4-(2-methoxyphenyl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 142649118 |
| Molecular Formula | C17H23BO3 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1S,2S,6S,8S)-4-(2-methoxyphenyl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | COc1ccccc1B1O[C@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C17H23BO3/c1-16(2)11-9-14(16)17(3)15(10-11)20-18(21-17)12-7-5-6-8-13(12)19-4/h5-8,11,14-15H,9-10H2,1-4H3/t11-,14-,15-,17-/m0/s1 |
| InChIKey | SPFOTFLTCNVUJL-SIUGBPQLSA-N |
| XLogP | 2.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|