C16H23BO2S — CID 100885882
(1S,2R,6R,8R)-4-(2,4-dimethylthiophen-3-yl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 100885882) has the molecular formula C16H23BO2S and a molecular weight of 290.24 g/mol. Its IUPAC name is (1S,2R,6R,8R)-4-(2,4-dimethylthiophen-3-yl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2R,6R,8R)-4-(2,4-dimethylthiophen-3-yl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 100885882 |
| Molecular Formula | C16H23BO2S |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1S,2R,6R,8R)-4-(2,4-dimethylthiophen-3-yl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | Cc1csc(C)c1B1O[C@@H]2C[C@H]3C[C@@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C16H23BO2S/c1-9-8-20-10(2)14(9)17-18-13-7-11-6-12(15(11,3)4)16(13,5)19-17/h8,11-13H,6-7H2,1-5H3/t11-,12+,13-,16-/m1/s1 |
| InChIKey | FUJBCBCBJHEVGI-OQMKEHIESA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|