C14H25BO2 — CID 123353253
4-tert-butyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 123353253) has the molecular formula C14H25BO2 and a molecular weight of 236.16 g/mol. Its IUPAC name is 4-tert-butyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | 4-tert-butyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 123353253 |
| Molecular Formula | C14H25BO2 |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 4-tert-butyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC(C)(C)B1OC2CC3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C14H25BO2/c1-12(2,3)15-16-11-8-9-7-10(13(9,4)5)14(11,6)17-15/h9-11H,7-8H2,1-6H3 |
| InChIKey | NKDBENDOEFLXLK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|