C14H28B2O3 — CID 91563454
methoxy(dimethyl)borane;2,4,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 91563454) has the molecular formula C14H28B2O3 and a molecular weight of 266.00 g/mol. Its IUPAC name is methoxy(dimethyl)borane;2,4,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | methoxy(dimethyl)borane;2,4,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 91563454 |
| Molecular Formula | C14H28B2O3 |
| Molecular Weight | 266.00 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | methoxy(dimethyl)borane;2,4,9,9-tetramethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CB1OC2CC3CC(C3(C)C)C2(C)O1.COB(C)C |
| InChI | InChI=1S/C11H19BO2.C3H9BO/c1-10(2)7-5-8(10)11(3)9(6-7)13-12(4)14-11;1-4(2)5-3/h7-9H,5-6H2,1-4H3;1-3H3 |
| InChIKey | DRUSNTQUNHWSDB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.00 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|