C15H26BBrO2 — CID 145107297
(2S,6R)-4-(5-bromopentyl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 145107297) has the molecular formula C15H26BBrO2 and a molecular weight of 329.09 g/mol. Its IUPAC name is (2S,6R)-4-(5-bromopentyl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (2S,6R)-4-(5-bromopentyl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 145107297 |
| Molecular Formula | C15H26BBrO2 |
| Molecular Weight | 329.09 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (2S,6R)-4-(5-bromopentyl)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC1(C)C2CC1[C@]1(C)OB(CCCCCBr)O[C@@H]1C2 |
| InChI | InChI=1S/C15H26BBrO2/c1-14(2)11-9-12(14)15(3)13(10-11)18-16(19-15)7-5-4-6-8-17/h11-13H,4-10H2,1-3H3/t11?,12?,13-,15+/m1/s1 |
| InChIKey | GQELYNNFODWHGL-SJQFEJMWSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.09 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|