C33H55B2ClO4 — CID 158243683
4-[(1R)-1-chlorohept-6-enyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane;4-hex-5-enyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 158243683) has the molecular formula C33H55B2ClO4 and a molecular weight of 572.88 g/mol. Its IUPAC name is 4-[(1R)-1-chlorohept-6-enyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane;4-hex-5-enyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | 4-[(1R)-1-chlorohept-6-enyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane;4-hex-5-enyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 158243683 |
| Molecular Formula | C33H55B2ClO4 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.40 |
| IUPAC Name | 4-[(1R)-1-chlorohept-6-enyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane;4-hex-5-enyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=CCCCCB1OC2CC3CC(C3(C)C)C2(C)O1.C=CCCCC[C@H](Cl)B1OC2CC3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C17H28BClO2.C16H27BO2/c1-5-6-7-8-9-15(19)18-20-14-11-12-10-13(16(12,2)3)17(14,4)21-18;1-5-6-7-8-9-17-18-14-11-12-10-13(15(12,2)3)16(14,4)19-17/h5,12-15H,1,6-11H2,2-4H3;5,12-14H,1,6-11H2,2-4H3/t12?,13?,14?,15-,17?;/m0./s1 |
| InChIKey | GFWBKAUINUMREA-AKJYSGECSA-N |
| XLogP | 8.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|