C17H27BO2 — CID 145157440
(2S)-2,9,9-trimethyl-4-[(Z)-3-methylidenehex-4-enyl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 145157440) has the molecular formula C17H27BO2 and a molecular weight of 274.21 g/mol. Its IUPAC name is (2S)-2,9,9-trimethyl-4-[(Z)-3-methylidenehex-4-enyl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (2S)-2,9,9-trimethyl-4-[(Z)-3-methylidenehex-4-enyl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 145157440 |
| Molecular Formula | C17H27BO2 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (2S)-2,9,9-trimethyl-4-[(Z)-3-methylidenehex-4-enyl]-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C=C(/C=C\C)CCB1OC2CC3CC(C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C17H27BO2/c1-6-7-12(2)8-9-18-19-15-11-13-10-14(16(13,3)4)17(15,5)20-18/h6-7,13-15H,2,8-11H2,1,3-5H3/b7-6-/t13?,14?,15?,17-/m0/s1 |
| InChIKey | UAOJSRFWBGHUNN-ZOGRMYCSSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|