C15H25BO4S — CID 134903261
3-[2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylsulfanyl]propanoic acid (PubChem CID 134903261) has the molecular formula C15H25BO4S and a molecular weight of 312.24 g/mol. Its IUPAC name is 3-[2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylsulfanyl]propanoic acid.
| Compound Name | 3-[2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 134903261 |
| Molecular Formula | C15H25BO4S |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[2-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethylsulfanyl]propanoic acid |
| SMILES | CC1(C)C2CC1[C@]1(C)OB(CCSCCC(=O)O)O[C@@H]1C2 |
| InChI | InChI=1S/C15H25BO4S/c1-14(2)10-8-11(14)15(3)12(9-10)19-16(20-15)5-7-21-6-4-13(17)18/h10-12H,4-9H2,1-3H3,(H,17,18)/t10?,11?,12-,15+/m1/s1 |
| InChIKey | MVYGXFYIWNQCEZ-KQFUTBAXSA-N |
| XLogP | 2.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|