C20H38BClO3Si — CID 132586884
tert-butyl-[(4S)-4-chloro-4-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butoxy]-dimethylsilane (PubChem CID 132586884) has the molecular formula C20H38BClO3Si and a molecular weight of 400.87 g/mol. Its IUPAC name is tert-butyl-[(4S)-4-chloro-4-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4S)-4-chloro-4-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 132586884 |
| Molecular Formula | C20H38BClO3Si |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | tert-butyl-[(4S)-4-chloro-4-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butoxy]-dimethylsilane |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cl)CCCO[Si](C)(C)C(C)(C)C)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C20H38BClO3Si/c1-18(2,3)26(7,8)23-11-9-10-17(22)21-24-16-13-14-12-15(19(14,4)5)20(16,6)25-21/h14-17H,9-13H2,1-8H3/t14-,15-,16+,17+,20-/m0/s1 |
| InChIKey | JFVPBGFDVMMYCU-WNSDDWSPSA-N |
| XLogP | 5.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|