C18H30BNO4 — CID 159707909
carbon dioxide;(3R)-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine (PubChem CID 159707909) has the molecular formula C18H30BNO4 and a molecular weight of 335.25 g/mol. Its IUPAC name is carbon dioxide;(3R)-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine.
| Compound Name | carbon dioxide;(3R)-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine |
|---|---|
| PubChem CID | 159707909 |
| Molecular Formula | C18H30BNO4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | carbon dioxide;(3R)-3-[3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]pyrrolidine |
| SMILES | CC1(C)[C@H]2C[C@@H]3OB(CCC[C@@H]4CCNC4)O[C@]3(C)[C@@H]1C2.O=C=O |
| InChI | InChI=1S/C17H30BNO2.CO2/c1-16(2)13-9-14(16)17(3)15(10-13)20-18(21-17)7-4-5-12-6-8-19-11-12;2-1-3/h12-15,19H,4-11H2,1-3H3;/t12-,13-,14-,15+,17-;/m1./s1 |
| InChIKey | MYLLNVRBSLHTAW-WTDSURRFSA-N |
| XLogP | 2.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|