C16H27BO2 — CID 102243641
(2S,6S)-4-cyclohexyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 102243641) has the molecular formula C16H27BO2 and a molecular weight of 262.20 g/mol. Its IUPAC name is (2S,6S)-4-cyclohexyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (2S,6S)-4-cyclohexyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 102243641 |
| Molecular Formula | C16H27BO2 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | (2S,6S)-4-cyclohexyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC1(C)C2CC1[C@]1(C)OB(C3CCCCC3)O[C@H]1C2 |
| InChI | InChI=1S/C16H27BO2/c1-15(2)11-9-13(15)16(3)14(10-11)18-17(19-16)12-7-5-4-6-8-12/h11-14H,4-10H2,1-3H3/t11?,13?,14-,16-/m0/s1 |
| InChIKey | ZXYKYFYHWLCPDV-DTVYBNOISA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|