C12H22BNO2 — CID 175900624
N-ethyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-amine (PubChem CID 175900624) has the molecular formula C12H22BNO2 and a molecular weight of 223.12 g/mol. Its IUPAC name is N-ethyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-amine.
| Compound Name | N-ethyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-amine |
|---|---|
| PubChem CID | 175900624 |
| Molecular Formula | C12H22BNO2 |
| Molecular Weight | 223.12 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-ethyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-amine |
| SMILES | CCNB1OC2CC3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C12H22BNO2/c1-5-14-13-15-10-7-8-6-9(11(8,2)3)12(10,4)16-13/h8-10,14H,5-7H2,1-4H3 |
| InChIKey | NRJBYKTZYKWPMP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|