C24H36BBrO3 — CID 10885076
2-bromo-1-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]octan-3-ol (PubChem CID 10885076) has the molecular formula C24H36BBrO3 and a molecular weight of 463.27 g/mol. Its IUPAC name is 2-bromo-1-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]octan-3-ol.
| Compound Name | 2-bromo-1-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]octan-3-ol |
|---|---|
| PubChem CID | 10885076 |
| Molecular Formula | C24H36BBrO3 |
| Molecular Weight | 463.27 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-bromo-1-[2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]octan-3-ol |
| SMILES | CCCCCC(O)C(Br)Cc1ccccc1B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C24H36BBrO3/c1-5-6-7-12-20(27)19(26)13-16-10-8-9-11-18(16)25-28-22-15-17-14-21(23(17,2)3)24(22,4)29-25/h8-11,17,19-22,27H,5-7,12-15H2,1-4H3/t17-,19?,20?,21-,22+,24-/m0/s1 |
| InChIKey | PTAKMAZWXVDQIA-DFSBTGPOSA-N |
| XLogP | 4.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|