C21H38BNO3 — CID 160942730
(2S)-2-methyl-N-[(2R)-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-2-yl]heptanamide (PubChem CID 160942730) has the molecular formula C21H38BNO3 and a molecular weight of 363.35 g/mol. Its IUPAC name is (2S)-2-methyl-N-[(2R)-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-2-yl]heptanamide.
| Compound Name | (2S)-2-methyl-N-[(2R)-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-2-yl]heptanamide |
|---|---|
| PubChem CID | 160942730 |
| Molecular Formula | C21H38BNO3 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | (2S)-2-methyl-N-[(2R)-1-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-2-yl]heptanamide |
| SMILES | CCCCC[C@H](C)C(=O)N[C@H](C)CB1OC2CC3CC(C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C21H38BNO3/c1-7-8-9-10-14(2)19(24)23-15(3)13-22-25-18-12-16-11-17(20(16,4)5)21(18,6)26-22/h14-18H,7-13H2,1-6H3,(H,23,24)/t14-,15+,16?,17?,18?,21+/m0/s1 |
| InChIKey | SUSGJGWDEUHKDS-ZELZTABASA-N |
| XLogP | 4.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|