C22H41BNO3+ — CID 162021262
[(2R,3S,6S)-3-methyl-5-oxo-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-6-yl]azanium (PubChem CID 162021262) has the molecular formula C22H41BNO3+ and a molecular weight of 378.39 g/mol. Its IUPAC name is [(2R,3S,6S)-3-methyl-5-oxo-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-6-yl]azanium.
| Compound Name | [(2R,3S,6S)-3-methyl-5-oxo-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-6-yl]azanium |
|---|---|
| PubChem CID | 162021262 |
| Molecular Formula | C22H41BNO3+ |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | [(2R,3S,6S)-3-methyl-5-oxo-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-6-yl]azanium |
| SMILES | CCCCC[C@H]([NH3+])C(=O)C[C@H](C)[C@@H](C)B1OC2CC3CC(C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C22H40BNO3/c1-7-8-9-10-17(24)18(25)11-14(2)15(3)23-26-20-13-16-12-19(21(16,4)5)22(20,6)27-23/h14-17,19-20H,7-13,24H2,1-6H3/p+1/t14-,15+,16?,17-,19?,20?,22+/m0/s1 |
| InChIKey | YUTXSNFMALHPJL-FTGFGTABSA-O |
| XLogP | 3.89 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|