C28H42BCl2F3NO4- — CID 158812818
[(2S,6S)-5-oxo-1-[4-(trifluoromethoxy)phenyl]-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-6-yl]azanium dichloride (PubChem CID 158812818) has the molecular formula C28H42BCl2F3NO4- and a molecular weight of 595.36 g/mol. Its IUPAC name is [(2S,6S)-5-oxo-1-[4-(trifluoromethoxy)phenyl]-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-6-yl]azanium dichloride.
| Compound Name | [(2S,6S)-5-oxo-1-[4-(trifluoromethoxy)phenyl]-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-6-yl]azanium dichloride |
|---|---|
| PubChem CID | 158812818 |
| Molecular Formula | C28H42BCl2F3NO4- |
| Molecular Weight | 595.36 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | [(2S,6S)-5-oxo-1-[4-(trifluoromethoxy)phenyl]-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-6-yl]azanium dichloride |
| SMILES | CCCCC[C@H]([NH3+])C(=O)CC[C@@H](Cc1ccc(OC(F)(F)F)cc1)B1OC2CC3CC(C3(C)C)[C@@]2(C)O1.[Cl-].[Cl-] |
| InChI | InChI=1S/C28H41BF3NO4.2ClH/c1-5-6-7-8-22(33)23(34)14-11-20(15-18-9-12-21(13-10-18)35-28(30,31)32)29-36-25-17-19-16-24(26(19,2)3)27(25,4)37-29;;/h9-10,12-13,19-20,22,24-25H,5-8,11,14-17,33H2,1-4H3;2*1H/p-1/t19?,20-,22-,24?,25?,27+;;/m0../s1 |
| InChIKey | QODBTTIIGARMQU-YLKBRCSXSA-M |
| XLogP | -0.23 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|