C28H44BNO3 — CID 146690208
(2R,3S,6S)-6-amino-3-methyl-1-phenyl-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-5-one (PubChem CID 146690208) has the molecular formula C28H44BNO3 and a molecular weight of 453.48 g/mol. Its IUPAC name is (2R,3S,6S)-6-amino-3-methyl-1-phenyl-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-5-one.
| Compound Name | (2R,3S,6S)-6-amino-3-methyl-1-phenyl-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-5-one |
|---|---|
| PubChem CID | 146690208 |
| Molecular Formula | C28H44BNO3 |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | (2R,3S,6S)-6-amino-3-methyl-1-phenyl-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]undecan-5-one |
| SMILES | CCCCC[C@H](N)C(=O)C[C@H](C)[C@@H](Cc1ccccc1)B1OC2CC3CC(C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C28H44BNO3/c1-6-7-9-14-23(30)24(31)15-19(2)22(16-20-12-10-8-11-13-20)29-32-26-18-21-17-25(27(21,3)4)28(26,5)33-29/h8,10-13,19,21-23,25-26H,6-7,9,14-18,30H2,1-5H3/t19-,21?,22+,23-,25?,26?,28+/m0/s1 |
| InChIKey | QFQNQPWALXTSMA-ZAYAAUDOSA-N |
| XLogP | 5.83 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|