C19H29BClNO3 — CID 142596368
methyl hypochlorite;2-phenyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine (PubChem CID 142596368) has the molecular formula C19H29BClNO3 and a molecular weight of 365.71 g/mol. Its IUPAC name is methyl hypochlorite;2-phenyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine.
| Compound Name | methyl hypochlorite;2-phenyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
|---|---|
| PubChem CID | 142596368 |
| Molecular Formula | C19H29BClNO3 |
| Molecular Weight | 365.71 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | methyl hypochlorite;2-phenyl-1-[(2S,6R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine |
| SMILES | CC1(C)C2CC1[C@]1(C)OB(C(N)Cc3ccccc3)O[C@@H]1C2.COCl |
| InChI | InChI=1S/C18H26BNO2.CH3ClO/c1-17(2)13-10-14(17)18(3)15(11-13)21-19(22-18)16(20)9-12-7-5-4-6-8-12;1-3-2/h4-8,13-16H,9-11,20H2,1-3H3;1H3/t13?,14?,15-,16?,18+;/m1./s1 |
| InChIKey | XKCWOPSDSKODFR-VVGWBAGDSA-N |
| XLogP | 3.61 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|