C28H37BNO3+ — CID 162114296
[(2S,6S)-3-oxo-1,6-diphenyl-6-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexan-2-yl]azanium (PubChem CID 162114296) has the molecular formula C28H37BNO3+ and a molecular weight of 446.42 g/mol. Its IUPAC name is [(2S,6S)-3-oxo-1,6-diphenyl-6-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexan-2-yl]azanium.
| Compound Name | [(2S,6S)-3-oxo-1,6-diphenyl-6-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexan-2-yl]azanium |
|---|---|
| PubChem CID | 162114296 |
| Molecular Formula | C28H37BNO3+ |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | [(2S,6S)-3-oxo-1,6-diphenyl-6-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]hexan-2-yl]azanium |
| SMILES | CC1(C)C2CC3OB([C@@H](CCC(=O)[C@@H]([NH3+])Cc4ccccc4)c4ccccc4)O[C@]3(C)C1C2 |
| InChI | InChI=1S/C28H36BNO3/c1-27(2)21-17-25(27)28(3)26(18-21)32-29(33-28)22(20-12-8-5-9-13-20)14-15-24(31)23(30)16-19-10-6-4-7-11-19/h4-13,21-23,25-26H,14-18,30H2,1-3H3/p+1/t21?,22-,23-,25?,26?,28+/m0/s1 |
| InChIKey | ZGOFWUZDBHCRKI-UGHJXWEWSA-O |
| XLogP | 4.24 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|