C25H41BClN3O3 — CID 86576323
[(2S)-6-amino-1-oxo-1-[[3-phenyl-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]hexan-2-yl]azanium chloride (PubChem CID 86576323) has the molecular formula C25H41BClN3O3 and a molecular weight of 477.89 g/mol. Its IUPAC name is [(2S)-6-amino-1-oxo-1-[[3-phenyl-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]hexan-2-yl]azanium chloride.
| Compound Name | [(2S)-6-amino-1-oxo-1-[[3-phenyl-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]hexan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 86576323 |
| Molecular Formula | C25H41BClN3O3 |
| Molecular Weight | 477.89 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | [(2S)-6-amino-1-oxo-1-[[3-phenyl-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]hexan-2-yl]azanium chloride |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB(C(CNC(=O)[C@@H]([NH3+])CCCCN)Cc4ccccc4)O[C@@]3(C)[C@H]1C2.[Cl-] |
| InChI | InChI=1S/C25H40BN3O3.ClH/c1-24(2)18-14-21(24)25(3)22(15-18)31-26(32-25)19(13-17-9-5-4-6-10-17)16-29-23(30)20(28)11-7-8-12-27;/h4-6,9-10,18-22H,7-8,11-16,27-28H2,1-3H3,(H,29,30);1H/t18-,19?,20-,21-,22+,25-;/m0./s1 |
| InChIKey | ADBSSBBHUOHZNP-ATHWBVFPSA-N |
| XLogP | -0.81 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.89 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|