C34H63BN4O5 — CID 68535313
N-[(2S)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxo-3-(pentylcarbamoylamino)propan-2-yl]decanamide (PubChem CID 68535313) has the molecular formula C34H63BN4O5 and a molecular weight of 618.71 g/mol. Its IUPAC name is N-[(2S)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxo-3-(pentylcarbamoylamino)propan-2-yl]decanamide.
| Compound Name | N-[(2S)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxo-3-(pentylcarbamoylamino)propan-2-yl]decanamide |
|---|---|
| PubChem CID | 68535313 |
| Molecular Formula | C34H63BN4O5 |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.49 |
| IUPAC Name | N-[(2S)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxo-3-(pentylcarbamoylamino)propan-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)N[C@@H](CNC(=O)NCCCCC)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C34H63BN4O5/c1-8-10-12-13-14-15-16-18-30(40)38-26(23-37-32(42)36-19-17-11-9-2)31(41)39-29(20-24(3)4)35-43-28-22-25-21-27(33(25,5)6)34(28,7)44-35/h24-29H,8-23H2,1-7H3,(H,38,40)(H,39,41)(H2,36,37,42)/t25-,26-,27-,28+,29-,34-/m0/s1 |
| InChIKey | HHOHVEYBIQRHRP-OFVDLYQGSA-N |
| XLogP | 5.90 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|