C30H53BN2O6 — CID 123433901
tert-butyl (3S)-3-[(hexanoylamino)methyl]-4-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-oxobutanoate (PubChem CID 123433901) has the molecular formula C30H53BN2O6 and a molecular weight of 548.57 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(hexanoylamino)methyl]-4-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-[(hexanoylamino)methyl]-4-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123433901 |
| Molecular Formula | C30H53BN2O6 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.40 |
| IUPAC Name | tert-butyl (3S)-3-[(hexanoylamino)methyl]-4-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-oxobutanoate |
| SMILES | CCCCCC(=O)NC[C@H](CC(=O)OC(C)(C)C)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C30H53BN2O6/c1-10-11-12-13-25(34)32-18-20(15-26(35)37-28(4,5)6)27(36)33-24(14-19(2)3)31-38-23-17-21-16-22(29(21,7)8)30(23,9)39-31/h19-24H,10-18H2,1-9H3,(H,32,34)(H,33,36)/t20-,21-,22-,23+,24-,30-/m0/s1 |
| InChIKey | IAARNPGNECUONO-QWZNWVEGSA-N |
| XLogP | 4.83 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|