C36H58BN3O5 — CID 58301697
(2S)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxo-2-[(phenylcarbamoylamino)methyl]tridecanamide (PubChem CID 58301697) has the molecular formula C36H58BN3O5 and a molecular weight of 623.69 g/mol. Its IUPAC name is (2S)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxo-2-[(phenylcarbamoylamino)methyl]tridecanamide.
| Compound Name | (2S)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxo-2-[(phenylcarbamoylamino)methyl]tridecanamide |
|---|---|
| PubChem CID | 58301697 |
| Molecular Formula | C36H58BN3O5 |
| Molecular Weight | 623.69 g/mol |
| Exact Mass | 623.45 |
| IUPAC Name | (2S)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxo-2-[(phenylcarbamoylamino)methyl]tridecanamide |
| SMILES | CCCCCCCCCC(=O)C[C@@H](CNC(=O)Nc1ccccc1)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C36H58BN3O5/c1-7-8-9-10-11-12-16-19-29(41)21-26(24-38-34(43)39-28-17-14-13-15-18-28)33(42)40-32(20-25(2)3)37-44-31-23-27-22-30(35(27,4)5)36(31,6)45-37/h13-15,17-18,25-27,30-32H,7-12,16,19-24H2,1-6H3,(H,40,42)(H2,38,39,43)/t26-,27+,30+,31+,32-,36-/m0/s1 |
| InChIKey | AXXHXPVCYRSUCS-SPYYGMKPSA-N |
| XLogP | 7.32 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.69 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|