C35H63BN2O5 — CID 123946682
(2S)-2-[(hexanoylamino)methyl]-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxotridecanamide (PubChem CID 123946682) has the molecular formula C35H63BN2O5 and a molecular weight of 602.71 g/mol. Its IUPAC name is (2S)-2-[(hexanoylamino)methyl]-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxotridecanamide.
| Compound Name | (2S)-2-[(hexanoylamino)methyl]-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxotridecanamide |
|---|---|
| PubChem CID | 123946682 |
| Molecular Formula | C35H63BN2O5 |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.48 |
| IUPAC Name | (2S)-2-[(hexanoylamino)methyl]-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxotridecanamide |
| SMILES | CCCCCCCCCC(=O)C[C@@H](CNC(=O)CCCCC)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C35H63BN2O5/c1-8-10-12-13-14-15-17-18-28(39)21-26(24-37-32(40)19-16-11-9-2)33(41)38-31(20-25(3)4)36-42-30-23-27-22-29(34(27,5)6)35(30,7)43-36/h25-27,29-31H,8-24H2,1-7H3,(H,37,40)(H,38,41)/t26-,27-,29-,30+,31-,35-/m0/s1 |
| InChIKey | OXHHPDSVGDJJCB-LROSTOAQSA-N |
| XLogP | 7.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|