C24H45BClN3O4 — CID 162324800
N-[(2S)-2-amino-3-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]hexanamide;hydrochloride (PubChem CID 162324800) has the molecular formula C24H45BClN3O4 and a molecular weight of 485.91 g/mol. Its IUPAC name is N-[(2S)-2-amino-3-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]hexanamide;hydrochloride.
| Compound Name | N-[(2S)-2-amino-3-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]hexanamide;hydrochloride |
|---|---|
| PubChem CID | 162324800 |
| Molecular Formula | C24H45BClN3O4 |
| Molecular Weight | 485.91 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | N-[(2S)-2-amino-3-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]hexanamide;hydrochloride |
| SMILES | CCCCCC(=O)NC[C@H](N)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1.Cl |
| InChI | InChI=1S/C24H44BN3O4.ClH/c1-7-8-9-10-21(29)27-14-17(26)22(30)28-20(11-15(2)3)25-31-19-13-16-12-18(23(16,4)5)24(19,6)32-25;/h15-20H,7-14,26H2,1-6H3,(H,27,29)(H,28,30);1H/t16-,17-,18-,19+,20-,24-;/m0./s1 |
| InChIKey | PYYHYMFKKAMHEG-HKBWLHEBSA-N |
| XLogP | 3.23 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.91 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|