C45H64BNO6 — CID 123942983
9H-fluoren-9-ylmethyl (4R)-4-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoyl]-6-oxopentadecanoate (PubChem CID 123942983) has the molecular formula C45H64BNO6 and a molecular weight of 725.82 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (4R)-4-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoyl]-6-oxopentadecanoate.
| Compound Name | 9H-fluoren-9-ylmethyl (4R)-4-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoyl]-6-oxopentadecanoate |
|---|---|
| PubChem CID | 123942983 |
| Molecular Formula | C45H64BNO6 |
| Molecular Weight | 725.82 g/mol |
| Exact Mass | 725.48 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (4R)-4-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoyl]-6-oxopentadecanoate |
| SMILES | CCCCCCCCCC(=O)CC(CCC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C45H64BNO6/c1-7-8-9-10-11-12-13-18-33(48)26-31(23-24-42(49)51-29-38-36-21-16-14-19-34(36)35-20-15-17-22-37(35)38)43(50)47-41(25-30(2)3)46-52-40-28-32-27-39(44(32,4)5)45(40,6)53-46/h14-17,19-22,30-32,38-41H,7-13,18,23-29H2,1-6H3,(H,47,50)/t31?,32-,39-,40+,41-,45-/m0/s1 |
| InChIKey | XHHRYRGGCRSBGF-SFBGUJPWSA-N |
| XLogP | 9.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.82 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|