C32H45BN2O4 — CID 167625987
(2R)-5-cyclopropyl-2-(1H-indol-3-ylmethyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxopentanamide (PubChem CID 167625987) has the molecular formula C32H45BN2O4 and a molecular weight of 532.53 g/mol. Its IUPAC name is (2R)-5-cyclopropyl-2-(1H-indol-3-ylmethyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxopentanamide.
| Compound Name | (2R)-5-cyclopropyl-2-(1H-indol-3-ylmethyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 167625987 |
| Molecular Formula | C32H45BN2O4 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | (2R)-5-cyclopropyl-2-(1H-indol-3-ylmethyl)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxopentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)CC1CC1)Cc1c[nH]c2ccccc12)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C32H45BN2O4/c1-19(2)12-29(33-38-28-17-23-16-27(31(23,3)4)32(28,5)39-33)35-30(37)21(15-24(36)13-20-10-11-20)14-22-18-34-26-9-7-6-8-25(22)26/h6-9,18-21,23,27-29,34H,10-17H2,1-5H3,(H,35,37)/t21-,23+,27+,28-,29+,32+/m1/s1 |
| InChIKey | NCKYAQKXHZIDLI-KPCKMESJSA-N |
| XLogP | 5.88 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|