C28H48BN3O7 — CID 175907281
tert-butyl N-[(2R)-1-[[(1R)-3-methyl-1-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-morpholin-4-yl-1,4-dioxobutan-2-yl]carbamate (PubChem CID 175907281) has the molecular formula C28H48BN3O7 and a molecular weight of 549.52 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(1R)-3-methyl-1-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-morpholin-4-yl-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(1R)-3-methyl-1-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-morpholin-4-yl-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 175907281 |
| Molecular Formula | C28H48BN3O7 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(1R)-3-methyl-1-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-morpholin-4-yl-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)N1CCOCC1)NC(=O)OC(C)(C)C)B1O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C28H48BN3O7/c1-17(2)13-22(29-38-21-15-18-14-20(27(18,6)7)28(21,8)39-29)31-24(34)19(30-25(35)37-26(3,4)5)16-23(33)32-9-11-36-12-10-32/h17-22H,9-16H2,1-8H3,(H,30,35)(H,31,34)/t18-,19-,20-,21+,22+,28-/m1/s1 |
| InChIKey | WAPKTVDTXHGQDE-NYVBYPIGSA-N |
| XLogP | 2.93 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|