C25H45BN2O7S — CID 58301794
tert-butyl (3S)-3-(methanesulfonamidomethyl)-4-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-oxobutanoate (PubChem CID 58301794) has the molecular formula C25H45BN2O7S and a molecular weight of 528.52 g/mol. Its IUPAC name is tert-butyl (3S)-3-(methanesulfonamidomethyl)-4-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-(methanesulfonamidomethyl)-4-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 58301794 |
| Molecular Formula | C25H45BN2O7S |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | tert-butyl (3S)-3-(methanesulfonamidomethyl)-4-[[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-4-oxobutanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CNS(C)(=O)=O)CC(=O)OC(C)(C)C)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C25H45BN2O7S/c1-15(2)10-20(26-34-19-13-17-12-18(24(17,6)7)25(19,8)35-26)28-22(30)16(14-27-36(9,31)32)11-21(29)33-23(3,4)5/h15-20,27H,10-14H2,1-9H3,(H,28,30)/t16-,17+,18+,19+,20-,25-/m0/s1 |
| InChIKey | YPAQVPJFSVLYOO-CQNAMBCCSA-N |
| XLogP | 2.68 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|