C25H29BFNO2 — CID 102037806
1-[4-fluoro-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]-N-[(1R)-1-phenylethyl]methanimine (PubChem CID 102037806) has the molecular formula C25H29BFNO2 and a molecular weight of 405.32 g/mol. Its IUPAC name is 1-[4-fluoro-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]-N-[(1R)-1-phenylethyl]methanimine.
| Compound Name | 1-[4-fluoro-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]-N-[(1R)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 102037806 |
| Molecular Formula | C25H29BFNO2 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-[4-fluoro-2-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]phenyl]-N-[(1R)-1-phenylethyl]methanimine |
| SMILES | C[C@@H](/N=C/c1ccc(F)cc1B1O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1)c1ccccc1 |
| InChI | InChI=1S/C25H29BFNO2/c1-16(17-8-6-5-7-9-17)28-15-18-10-11-20(27)14-21(18)26-29-23-13-19-12-22(24(19,2)3)25(23,4)30-26/h5-11,14-16,19,22-23H,12-13H2,1-4H3/b28-15+/t16-,19-,22-,23+,25-/m1/s1 |
| InChIKey | DEPOXOSJTCBUAT-NOBKJUDZSA-N |
| XLogP | 4.94 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|