C31H45BO3Si2 — CID 135061381
dimethyl-phenyl-[(1R,2S)-1-phenyl-3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-1-trimethylsilyloxybut-3-en-2-yl]silane (PubChem CID 135061381) has the molecular formula C31H45BO3Si2 and a molecular weight of 532.68 g/mol. Its IUPAC name is dimethyl-phenyl-[(1R,2S)-1-phenyl-3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-1-trimethylsilyloxybut-3-en-2-yl]silane.
| Compound Name | dimethyl-phenyl-[(1R,2S)-1-phenyl-3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-1-trimethylsilyloxybut-3-en-2-yl]silane |
|---|---|
| PubChem CID | 135061381 |
| Molecular Formula | C31H45BO3Si2 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | dimethyl-phenyl-[(1R,2S)-1-phenyl-3-[(1R,2R,6S,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-1-trimethylsilyloxybut-3-en-2-yl]silane |
| SMILES | C=C(B1O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1)[C@@H]([C@H](O[Si](C)(C)C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C31H45BO3Si2/c1-22(32-33-27-21-24-20-26(30(24,2)3)31(27,4)35-32)29(37(8,9)25-18-14-11-15-19-25)28(34-36(5,6)7)23-16-12-10-13-17-23/h10-19,24,26-29H,1,20-21H2,2-9H3/t24-,26-,27+,28-,29+,31-/m1/s1 |
| InChIKey | HBRWBOUHFKVWHJ-RVXSRSKPSA-N |
| XLogP | 7.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|