C36H52B2O12 — CID 161491553
tert-butyl 2,6-dimethoxy-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate;[2,4-dimethoxy-3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid (PubChem CID 161491553) has the molecular formula C36H52B2O12 and a molecular weight of 698.42 g/mol. Its IUPAC name is tert-butyl 2,6-dimethoxy-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate;[2,4-dimethoxy-3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid.
| Compound Name | tert-butyl 2,6-dimethoxy-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate;[2,4-dimethoxy-3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 161491553 |
| Molecular Formula | C36H52B2O12 |
| Molecular Weight | 698.42 g/mol |
| Exact Mass | 698.36 |
| IUPAC Name | tert-butyl 2,6-dimethoxy-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate;[2,4-dimethoxy-3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(OC)c1C(=O)OC(C)(C)C.COc1ccc(B2OC3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)c(OC)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33BO6.C13H19BO6/c1-21(2,3)28-20(25)18-15(26-7)10-9-14(19(18)27-8)24-29-17-12-13-11-16(22(13,4)5)23(17,6)30-24;1-13(2,3)20-12(15)10-9(18-4)7-6-8(14(16)17)11(10)19-5/h9-10,13,16-17H,11-12H2,1-8H3;6-7,16-17H,1-5H3/t13-,16-,17?,23-;/m0./s1 |
| InChIKey | WFRDTDFVTIIKBD-NKBFKIRMSA-N |
| XLogP | 3.93 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|