C23H31BF2O5 — CID 153367847
tert-butyl 2,3-difluoro-6-methoxy-5-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate (PubChem CID 153367847) has the molecular formula C23H31BF2O5 and a molecular weight of 436.30 g/mol. Its IUPAC name is tert-butyl 2,3-difluoro-6-methoxy-5-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate.
| Compound Name | tert-butyl 2,3-difluoro-6-methoxy-5-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 153367847 |
| Molecular Formula | C23H31BF2O5 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | tert-butyl 2,3-difluoro-6-methoxy-5-[[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]methyl]benzoate |
| SMILES | COc1c(CB2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc(F)c(F)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31BF2O5/c1-21(2,3)29-20(27)17-18(26)14(25)8-12(19(17)28-7)11-24-30-16-10-13-9-15(22(13,4)5)23(16,6)31-24/h8,13,15-16H,9-11H2,1-7H3/t13-,15-,16+,23-/m0/s1 |
| InChIKey | WUTSGNMGOCAHES-YYVJSBQZSA-N |
| XLogP | 4.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|