C26H37BO7 — CID 153470764
tert-butyl 6-(1,3-dioxan-2-yl)-2-methoxy-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate (PubChem CID 153470764) has the molecular formula C26H37BO7 and a molecular weight of 472.39 g/mol. Its IUPAC name is tert-butyl 6-(1,3-dioxan-2-yl)-2-methoxy-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate.
| Compound Name | tert-butyl 6-(1,3-dioxan-2-yl)-2-methoxy-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 153470764 |
| Molecular Formula | C26H37BO7 |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | tert-butyl 6-(1,3-dioxan-2-yl)-2-methoxy-3-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoate |
| SMILES | COc1c(B2OC3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)ccc(C2OCCCO2)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H37BO7/c1-24(2,3)32-22(28)20-16(23-30-11-8-12-31-23)9-10-17(21(20)29-7)27-33-19-14-15-13-18(25(15,4)5)26(19,6)34-27/h9-10,15,18-19,23H,8,11-14H2,1-7H3/t15-,18-,19?,26-/m0/s1 |
| InChIKey | GBGVRDUFPMOJHY-NLXZBFJOSA-N |
| XLogP | 4.02 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|