C19H25BO5 — CID 142704725
4-methoxy-3-[(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]benzoic acid (PubChem CID 142704725) has the molecular formula C19H25BO5 and a molecular weight of 344.22 g/mol. Its IUPAC name is 4-methoxy-3-[(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]benzoic acid.
| Compound Name | 4-methoxy-3-[(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 142704725 |
| Molecular Formula | C19H25BO5 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-methoxy-3-[(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1CB1OC2CC3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C19H25BO5/c1-18(2)13-8-15(18)19(3)16(9-13)24-20(25-19)10-12-7-11(17(21)22)5-6-14(12)23-4/h5-7,13,15-16H,8-10H2,1-4H3,(H,21,22) |
| InChIKey | DJTNPTLXHRPYCV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|