C13H18O4 — CID 144796211
4-cyclopropyloxy-3-(hydroxymethyl)benzoic acid;ethane (PubChem CID 144796211) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-cyclopropyloxy-3-(hydroxymethyl)benzoic acid;ethane.
| Compound Name | 4-cyclopropyloxy-3-(hydroxymethyl)benzoic acid;ethane |
|---|---|
| PubChem CID | 144796211 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-cyclopropyloxy-3-(hydroxymethyl)benzoic acid;ethane |
| SMILES | CC.O=C(O)c1ccc(OC2CC2)c(CO)c1 |
| InChI | InChI=1S/C11H12O4.C2H6/c12-6-8-5-7(11(13)14)1-4-10(8)15-9-2-3-9;1-2/h1,4-5,9,12H,2-3,6H2,(H,13,14);1-2H3 |
| InChIKey | MLYSLBZKOSWPEB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |