C13H14F3NO4 — CID 175135334
3-[2-(hydroxymethyl)-4-(trifluoromethyl)phenoxy]pyrrolidine-1-carboxylic acid (PubChem CID 175135334) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-4-(trifluoromethyl)phenoxy]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[2-(hydroxymethyl)-4-(trifluoromethyl)phenoxy]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175135334 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-[2-(hydroxymethyl)-4-(trifluoromethyl)phenoxy]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(Oc2ccc(C(F)(F)F)cc2CO)C1 |
| InChI | InChI=1S/C13H14F3NO4/c14-13(15,16)9-1-2-11(8(5-9)7-18)21-10-3-4-17(6-10)12(19)20/h1-2,5,10,18H,3-4,6-7H2,(H,19,20) |
| InChIKey | PDFPQTDPFDSLJA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |