C14H16F4N2O2 — CID 66591546
2-amino-1-[4-[2-fluoro-5-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone (PubChem CID 66591546) has the molecular formula C14H16F4N2O2 and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-amino-1-[4-[2-fluoro-5-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[4-[2-fluoro-5-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 66591546 |
| Molecular Formula | C14H16F4N2O2 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-amino-1-[4-[2-fluoro-5-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanone |
| SMILES | NCC(=O)N1CCC(Oc2cc(C(F)(F)F)ccc2F)CC1 |
| InChI | InChI=1S/C14H16F4N2O2/c15-11-2-1-9(14(16,17)18)7-12(11)22-10-3-5-20(6-4-10)13(21)8-19/h1-2,7,10H,3-6,8,19H2 |
| InChIKey | VYABPSLVTRJVDE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |