C13H15F4N3O — CID 63037864
4-[2-fluoro-5-(trifluoromethyl)anilino]piperidine-1-carboxamide (PubChem CID 63037864) has the molecular formula C13H15F4N3O and a molecular weight of 305.27 g/mol. Its IUPAC name is 4-[2-fluoro-5-(trifluoromethyl)anilino]piperidine-1-carboxamide.
| Compound Name | 4-[2-fluoro-5-(trifluoromethyl)anilino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 63037864 |
| Molecular Formula | C13H15F4N3O |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[2-fluoro-5-(trifluoromethyl)anilino]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(Nc2cc(C(F)(F)F)ccc2F)CC1 |
| InChI | InChI=1S/C13H15F4N3O/c14-10-2-1-8(13(15,16)17)7-11(10)19-9-3-5-20(6-4-9)12(18)21/h1-2,7,9,19H,3-6H2,(H2,18,21) |
| InChIKey | WDDPEAJWRBXKKM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |